C17H18ClN3O2 — CID 53146531
(E)-1-[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl]-3-(3-chlorophenyl)prop-2-en-1-one (PubChem CID 53146531) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is (E)-1-[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl]-3-(3-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl]-3-(3-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 53146531 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (E)-1-[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl]-3-(3-chlorophenyl)prop-2-en-1-one |
| SMILES | Nc1cc(C2CCN(C(=O)/C=C/c3cccc(Cl)c3)CC2)no1 |
| InChI | InChI=1S/C17H18ClN3O2/c18-14-3-1-2-12(10-14)4-5-17(22)21-8-6-13(7-9-21)15-11-16(19)23-20-15/h1-5,10-11,13H,6-9,19H2/b5-4+ |
| InChIKey | ULNIXLKYFNQKIM-SNAWJCMRSA-N |
| XLogP | 3.33 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|