C15H17N3O3 — CID 171136536
1-[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 171136536) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | 1-[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 171136536 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | Nc1cc(C2CCN(C(=O)C=Cc3ccco3)CC2)no1 |
| InChI | InChI=1S/C15H17N3O3/c16-14-10-13(17-21-14)11-5-7-18(8-6-11)15(19)4-3-12-2-1-9-20-12/h1-4,9-11H,5-8,16H2 |
| InChIKey | PZLLVDHCYKYJJR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|