C17H20N4O3 — CID 91942902
1-[4-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]piperazin-1-yl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 91942902) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-[4-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]piperazin-1-yl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | 1-[4-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]piperazin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91942902 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[4-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]piperazin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccco1)N1CCN(Cc2noc(C3CC3)n2)CC1 |
| InChI | InChI=1S/C17H20N4O3/c22-16(6-5-14-2-1-11-23-14)21-9-7-20(8-10-21)12-15-18-17(24-19-15)13-3-4-13/h1-2,5-6,11,13H,3-4,7-10,12H2 |
| InChIKey | RFQAENSYAATFRZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 75.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|