C17H21ClN2O3S — CID 134033949
(E)-3-(3-chlorophenyl)-1-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 134033949) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-1-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chlorophenyl)-1-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134033949 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-1-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C17H21ClN2O3S/c18-15-3-1-2-14(12-15)4-5-17(21)20-9-7-19(8-10-20)16-6-11-24(22,23)13-16/h1-5,12,16H,6-11,13H2/b5-4+ |
| InChIKey | QMEDZXOFWKBQDX-SNAWJCMRSA-N |
| XLogP | 1.68 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|