C17H20Cl2N2O3S — CID 8857598
(E)-3-(2,4-dichlorophenyl)-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 8857598) has the molecular formula C17H20Cl2N2O3S and a molecular weight of 403.33 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8857598 |
| Molecular Formula | C17H20Cl2N2O3S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C17H20Cl2N2O3S/c18-14-3-1-13(16(19)11-14)2-4-17(22)21-8-6-20(7-9-21)15-5-10-25(23,24)12-15/h1-4,11,15H,5-10,12H2/b4-2+/t15-/m0/s1 |
| InChIKey | UTBUPCGIBJSDRU-OMDKTOEGSA-N |
| XLogP | 2.34 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|