C18H20Cl2N2O3 — CID 4827545
3-(2,4-dichlorophenyl)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 4827545) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(2,4-dichlorophenyl)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4827545 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C18H20Cl2N2O3/c19-14-5-3-13(15(20)12-14)4-6-17(23)21-7-9-22(10-8-21)18(24)16-2-1-11-25-16/h3-6,12,16H,1-2,7-11H2 |
| InChIKey | JKGNBTDYBYVGFX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|