C19H21N3O4 — CID 103597613
3-(1,3-benzoxazol-2-yl)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 103597613) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 103597613 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-1-[4-(oxolane-2-carbonyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1nc2ccccc2o1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C19H21N3O4/c23-18(8-7-17-20-14-4-1-2-5-15(14)26-17)21-9-11-22(12-10-21)19(24)16-6-3-13-25-16/h1-2,4-5,7-8,16H,3,6,9-13H2 |
| InChIKey | FKULZHLMGUXDIX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|