C18H17N5O2 — CID 126805749
3-(1,3-benzoxazol-2-yl)-1-(4-pyrazin-2-ylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 126805749) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-1-(4-pyrazin-2-ylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-1-(4-pyrazin-2-ylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126805749 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-1-(4-pyrazin-2-ylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1nc2ccccc2o1)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C18H17N5O2/c24-18(6-5-17-21-14-3-1-2-4-15(14)25-17)23-11-9-22(10-12-23)16-13-19-7-8-20-16/h1-8,13H,9-12H2 |
| InChIKey | DXCUMZPRBXLAFJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|