C23H24N2O2 — CID 33309701
(E)-3-(1,3-benzoxazol-2-yl)-1-[4-(2-phenylethyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 33309701) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-1-[4-(2-phenylethyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-1-[4-(2-phenylethyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 33309701 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-1-[4-(2-phenylethyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)N1CCC(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H24N2O2/c26-23(13-12-22-24-20-8-4-5-9-21(20)27-22)25-16-14-19(15-17-25)11-10-18-6-2-1-3-7-18/h1-9,12-13,19H,10-11,14-17H2/b13-12+ |
| InChIKey | YXUYEKNMOSMDTN-OUKQBFOZSA-N |
| XLogP | 4.71 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|