C15H18ClFN2O4S — CID 51169379
[4-(4-chloro-2-fluorophenyl)sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 51169379) has the molecular formula C15H18ClFN2O4S and a molecular weight of 376.84 g/mol. Its IUPAC name is [4-(4-chloro-2-fluorophenyl)sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(4-chloro-2-fluorophenyl)sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 51169379 |
| Molecular Formula | C15H18ClFN2O4S |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [4-(4-chloro-2-fluorophenyl)sulfonylpiperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCN(S(=O)(=O)c2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C15H18ClFN2O4S/c16-11-3-4-14(12(17)10-11)24(21,22)19-7-5-18(6-8-19)15(20)13-2-1-9-23-13/h3-4,10,13H,1-2,5-9H2 |
| InChIKey | FROZFBFHGVAQIG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |