C20H21FN2O2 — CID 75407583
(E)-1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-3-pyridin-4-ylprop-2-en-1-one (PubChem CID 75407583) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is (E)-1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-3-pyridin-4-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-3-pyridin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 75407583 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (E)-1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-3-pyridin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccncc1)N1CCC(C(O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H21FN2O2/c21-18-4-2-16(3-5-18)20(25)17-9-13-23(14-10-17)19(24)6-1-15-7-11-22-12-8-15/h1-8,11-12,17,20,25H,9-10,13-14H2/b6-1+ |
| InChIKey | IBPJYIJVPIQVIT-LZCJLJQNSA-N |
| XLogP | 3.21 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|