C28H33F3N4S — CID 44534372
1-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 44534372) has the molecular formula C28H33F3N4S and a molecular weight of 514.66 g/mol. Its IUPAC name is 1-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 44534372 |
| Molecular Formula | C28H33F3N4S |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 1-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1ccc(NC(=S)NC2CCC(CN3CCC(c4c[nH]c5ccccc45)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H33F3N4S/c29-28(30,31)21-7-11-23(12-8-21)34-27(36)33-22-9-5-19(6-10-22)18-35-15-13-20(14-16-35)25-17-32-26-4-2-1-3-24(25)26/h1-4,7-8,11-12,17,19-20,22,32H,5-6,9-10,13-16,18H2,(H2,33,34,36) |
| InChIKey | DHGGXQSYHCUQKV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|