C29H33Cl2N3O — CID 45481428
(E)-3-(2,3-dichlorophenyl)-N-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide (PubChem CID 45481428) has the molecular formula C29H33Cl2N3O and a molecular weight of 510.51 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 45481428 |
| Molecular Formula | C29H33Cl2N3O |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)NC1CCC(CN2CCC(c3c[nH]c4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C29H33Cl2N3O/c30-26-6-3-4-22(29(26)31)10-13-28(35)33-23-11-8-20(9-12-23)19-34-16-14-21(15-17-34)25-18-32-27-7-2-1-5-24(25)27/h1-7,10,13,18,20-21,23,32H,8-9,11-12,14-17,19H2,(H,33,35)/b13-10+ |
| InChIKey | ZJCIUIWCAIUEHG-JLHYYAGUSA-N |
| XLogP | 7.04 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|