C28H32ClN3O2 — CID 70167595
(E)-1-(2-chlorophenyl)-3-[4-[[4-(5-hydroxy-1H-indol-3-yl)piperidin-1-yl]methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 70167595) has the molecular formula C28H32ClN3O2 and a molecular weight of 478.04 g/mol. Its IUPAC name is (E)-1-(2-chlorophenyl)-3-[4-[[4-(5-hydroxy-1H-indol-3-yl)piperidin-1-yl]methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2-chlorophenyl)-3-[4-[[4-(5-hydroxy-1H-indol-3-yl)piperidin-1-yl]methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70167595 |
| Molecular Formula | C28H32ClN3O2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (E)-1-(2-chlorophenyl)-3-[4-[[4-(5-hydroxy-1H-indol-3-yl)piperidin-1-yl]methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/N1CCC(CN2CCC(c3c[nH]c4ccc(O)cc34)CC2)CC1)c1ccccc1Cl |
| InChI | InChI=1S/C28H32ClN3O2/c29-26-4-2-1-3-23(26)28(34)11-16-31-12-7-20(8-13-31)19-32-14-9-21(10-15-32)25-18-30-27-6-5-22(33)17-24(25)27/h1-6,11,16-18,20-21,30,33H,7-10,12-15,19H2/b16-11+ |
| InChIKey | VOIGKLJTVVBYJG-LFIBNONCSA-N |
| XLogP | 5.81 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|