C30H34F3N3O2 — CID 69407582
3-[4-[3-hydroxy-2-[4-(1H-indol-3-yl)piperidin-1-yl]propyl]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one (PubChem CID 69407582) has the molecular formula C30H34F3N3O2 and a molecular weight of 525.62 g/mol. Its IUPAC name is 3-[4-[3-hydroxy-2-[4-(1H-indol-3-yl)piperidin-1-yl]propyl]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one.
| Compound Name | 3-[4-[3-hydroxy-2-[4-(1H-indol-3-yl)piperidin-1-yl]propyl]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69407582 |
| Molecular Formula | C30H34F3N3O2 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 3-[4-[3-hydroxy-2-[4-(1H-indol-3-yl)piperidin-1-yl]propyl]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=CN1CCC(CC(CO)N2CCC(c3c[nH]c4ccccc34)CC2)CC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C30H34F3N3O2/c31-26-16-22(17-27(32)30(26)33)29(38)9-12-35-10-5-20(6-11-35)15-23(19-37)36-13-7-21(8-14-36)25-18-34-28-4-2-1-3-24(25)28/h1-4,9,12,16-18,20-21,23,34,37H,5-8,10-11,13-15,19H2 |
| InChIKey | JYVJPWZPEDJYOY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|