C30H35F3N4O3 — CID 67080706
3-[4-[2,3-dihydroxypropyl-[4-(1H-indol-3-yl)piperidin-1-yl]amino]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one (PubChem CID 67080706) has the molecular formula C30H35F3N4O3 and a molecular weight of 556.63 g/mol. Its IUPAC name is 3-[4-[2,3-dihydroxypropyl-[4-(1H-indol-3-yl)piperidin-1-yl]amino]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one.
| Compound Name | 3-[4-[2,3-dihydroxypropyl-[4-(1H-indol-3-yl)piperidin-1-yl]amino]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67080706 |
| Molecular Formula | C30H35F3N4O3 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 3-[4-[2,3-dihydroxypropyl-[4-(1H-indol-3-yl)piperidin-1-yl]amino]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=CN1CCC(N(CC(O)CO)N2CCC(c3c[nH]c4ccccc34)CC2)CC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C30H35F3N4O3/c31-26-15-21(16-27(32)30(26)33)29(40)9-12-35-10-7-22(8-11-35)37(18-23(39)19-38)36-13-5-20(6-14-36)25-17-34-28-4-2-1-3-24(25)28/h1-4,9,12,15-17,20,22-23,34,38-39H,5-8,10-11,13-14,18-19H2 |
| InChIKey | BAKUXPOUHYOTTP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|