C31H35Cl2N3O — CID 70167298
(E)-1-(3,4-dichlorophenyl)-3-[4-[1-[3-(1H-indol-3-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 70167298) has the molecular formula C31H35Cl2N3O and a molecular weight of 536.55 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-3-[4-[1-[3-(1H-indol-3-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-3-[4-[1-[3-(1H-indol-3-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70167298 |
| Molecular Formula | C31H35Cl2N3O |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-3-[4-[1-[3-(1H-indol-3-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | CC(C1CCN(/C=C/C(=O)c2ccc(Cl)c(Cl)c2)CC1)N1C2CCC1CC(c1c[nH]c3ccccc13)C2 |
| InChI | InChI=1S/C31H35Cl2N3O/c1-20(21-10-13-35(14-11-21)15-12-31(37)22-6-9-28(32)29(33)18-22)36-24-7-8-25(36)17-23(16-24)27-19-34-30-5-3-2-4-26(27)30/h2-6,9,12,15,18-21,23-25,34H,7-8,10-11,13-14,16-17H2,1H3/b15-12+ |
| InChIKey | HBLGICUPTOFWDP-NTCAYCPXSA-N |
| XLogP | 7.68 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|