C30H35Cl2N3O2 — CID 70167609
(E)-1-(3,4-dichlorophenyl)-3-[4-[3-[4-(5-hydroxy-1H-indol-3-yl)piperidin-1-yl]propyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 70167609) has the molecular formula C30H35Cl2N3O2 and a molecular weight of 540.54 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-3-[4-[3-[4-(5-hydroxy-1H-indol-3-yl)piperidin-1-yl]propyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-3-[4-[3-[4-(5-hydroxy-1H-indol-3-yl)piperidin-1-yl]propyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70167609 |
| Molecular Formula | C30H35Cl2N3O2 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-3-[4-[3-[4-(5-hydroxy-1H-indol-3-yl)piperidin-1-yl]propyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/N1CCC(CCCN2CCC(c3c[nH]c4ccc(O)cc34)CC2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H35Cl2N3O2/c31-27-5-3-23(18-28(27)32)30(37)11-17-35-13-7-21(8-14-35)2-1-12-34-15-9-22(10-16-34)26-20-33-29-6-4-24(36)19-25(26)29/h3-6,11,17-22,33,36H,1-2,7-10,12-16H2/b17-11+ |
| InChIKey | RMKQQJQRFINCRF-GZTJUZNOSA-N |
| XLogP | 7.25 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|