C29H31F4N3O2 — CID 69402586
3-[4-[1-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one (PubChem CID 69402586) has the molecular formula C29H31F4N3O2 and a molecular weight of 529.58 g/mol. Its IUPAC name is 3-[4-[1-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one.
| Compound Name | 3-[4-[1-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69402586 |
| Molecular Formula | C29H31F4N3O2 |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 3-[4-[1-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]-1-(3,4,5-trifluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=CN1CCC(C(CO)N2CCC(c3c[nH]c4ccc(F)cc34)CC2)CC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C29H31F4N3O2/c30-21-1-2-26-22(15-21)23(16-34-26)18-5-11-36(12-6-18)27(17-37)19-3-8-35(9-4-19)10-7-28(38)20-13-24(31)29(33)25(32)14-20/h1-2,7,10,13-16,18-19,27,34,37H,3-6,8-9,11-12,17H2 |
| InChIKey | WMYBETJPWNENSI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|