C30H35Cl2N3O — CID 70167520
(E)-1-(3,4-dichlorophenyl)-3-[4-[2-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 70167520) has the molecular formula C30H35Cl2N3O and a molecular weight of 524.54 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-3-[4-[2-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-3-[4-[2-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70167520 |
| Molecular Formula | C30H35Cl2N3O |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-3-[4-[2-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1[nH]c2ccccc2c1C1CCN(CCC2CCN(/C=C/C(=O)c3ccc(Cl)c(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C30H35Cl2N3O/c1-21-30(25-4-2-3-5-28(25)33-21)23-11-17-35(18-12-23)16-10-22-8-14-34(15-9-22)19-13-29(36)24-6-7-26(31)27(32)20-24/h2-7,13,19-20,22-23,33H,8-12,14-18H2,1H3/b19-13+ |
| InChIKey | JOWHPXKMGMKKPT-CPNJWEJPSA-N |
| XLogP | 7.46 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|