C20H22N2O2S — CID 113087336
3-[1-(benzenesulfonyl)piperidin-4-yl]-2-methyl-1H-indole (PubChem CID 113087336) has the molecular formula C20H22N2O2S and a molecular weight of 354.47 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)piperidin-4-yl]-2-methyl-1H-indole.
| Compound Name | 3-[1-(benzenesulfonyl)piperidin-4-yl]-2-methyl-1H-indole |
|---|---|
| PubChem CID | 113087336 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-[1-(benzenesulfonyl)piperidin-4-yl]-2-methyl-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N2O2S/c1-15-20(18-9-5-6-10-19(18)21-15)16-11-13-22(14-12-16)25(23,24)17-7-3-2-4-8-17/h2-10,16,21H,11-14H2,1H3 |
| InChIKey | LUWGUJCMAIQEAN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|