C28H35N3O3S — CID 60552262
1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one (PubChem CID 60552262) has the molecular formula C28H35N3O3S and a molecular weight of 493.67 g/mol. Its IUPAC name is 1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one.
| Compound Name | 1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one |
|---|---|
| PubChem CID | 60552262 |
| Molecular Formula | C28H35N3O3S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-3-(4-piperidin-1-ylsulfonylphenyl)propan-1-one |
| SMILES | Cc1[nH]c2ccccc2c1C1CCN(C(=O)CCc2ccc(S(=O)(=O)N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C28H35N3O3S/c1-21-28(25-7-3-4-8-26(25)29-21)23-15-19-30(20-16-23)27(32)14-11-22-9-12-24(13-10-22)35(33,34)31-17-5-2-6-18-31/h3-4,7-10,12-13,23,29H,2,5-6,11,14-20H2,1H3 |
| InChIKey | BPLFAIZHHYBSKW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|