C23H26N2O2 — CID 113087303
2-(4-methoxyphenyl)-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]ethanone (PubChem CID 113087303) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-methoxyphenyl)-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 113087303 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]ethanone |
| SMILES | COc1ccc(CC(=O)N2CCC(c3c(C)[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-16-23(20-5-3-4-6-21(20)24-16)18-11-13-25(14-12-18)22(26)15-17-7-9-19(27-2)10-8-17/h3-10,18,24H,11-15H2,1-2H3 |
| InChIKey | HJQCNDPUAWBMHZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|