C27H33N3O3 — CID 60552904
4-methoxy-N-[3-methyl-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-1-oxobutan-2-yl]benzamide (PubChem CID 60552904) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-methoxy-N-[3-methyl-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[3-methyl-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 60552904 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 4-methoxy-N-[3-methyl-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)NC(C(=O)N2CCC(c3c(C)[nH]c4ccccc34)CC2)C(C)C)cc1 |
| InChI | InChI=1S/C27H33N3O3/c1-17(2)25(29-26(31)20-9-11-21(33-4)12-10-20)27(32)30-15-13-19(14-16-30)24-18(3)28-23-8-6-5-7-22(23)24/h5-12,17,19,25,28H,13-16H2,1-4H3,(H,29,31) |
| InChIKey | UBWHRNBHDAFNLZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|