C20H29N3O5 — CID 40742327
ethyl 4-[(2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoyl]piperazine-1-carboxylate (PubChem CID 40742327) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl 4-[(2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 40742327 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | ethyl 4-[(2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@@H](NC(=O)c2ccc(OC)cc2)C(C)C)CC1 |
| InChI | InChI=1S/C20H29N3O5/c1-5-28-20(26)23-12-10-22(11-13-23)19(25)17(14(2)3)21-18(24)15-6-8-16(27-4)9-7-15/h6-9,14,17H,5,10-13H2,1-4H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | XPHYJPIENLEBMO-KRWDZBQOSA-N |
| XLogP | 1.75 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |