C27H37N3O3 — CID 55944109
4-tert-butyl-N-[(2S)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 55944109) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2S)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[(2S)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55944109 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 4-tert-butyl-N-[(2S)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccc(N2CCN(C(=O)[C@@H](NC(=O)c3ccc(C(C)(C)C)cc3)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H37N3O3/c1-19(2)24(28-25(31)20-7-9-21(10-8-20)27(3,4)5)26(32)30-17-15-29(16-18-30)22-11-13-23(33-6)14-12-22/h7-14,19,24H,15-18H2,1-6H3,(H,28,31)/t24-/m0/s1 |
| InChIKey | XRRMEVNLQKSKQJ-DEOSSOPVSA-N |
| XLogP | 4.10 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|