C24H30N4O6 — CID 4875091
3,5-dimethoxy-N-[3-methyl-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxobutan-2-yl]benzamide (PubChem CID 4875091) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[3-methyl-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[3-methyl-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 4875091 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 3,5-dimethoxy-N-[3-methyl-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxobutan-2-yl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)C(C)C)c1 |
| InChI | InChI=1S/C24H30N4O6/c1-16(2)22(25-23(29)17-13-20(33-3)15-21(14-17)34-4)24(30)27-11-9-26(10-12-27)18-5-7-19(8-6-18)28(31)32/h5-8,13-16,22H,9-12H2,1-4H3,(H,25,29) |
| InChIKey | ZVTXSHQQCCCPMQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|