C23H29N3O4 — CID 7765651
N-[(2S)-1-[4-(2-hydroxyphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide (PubChem CID 7765651) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[(2S)-1-[4-(2-hydroxyphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide.
| Compound Name | N-[(2S)-1-[4-(2-hydroxyphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7765651 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[(2S)-1-[4-(2-hydroxyphenyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H](C(=O)N2CCN(c3ccccc3O)CC2)C(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-16(2)21(24-22(28)17-8-10-18(30-3)11-9-17)23(29)26-14-12-25(13-15-26)19-6-4-5-7-20(19)27/h4-11,16,21,27H,12-15H2,1-3H3,(H,24,28)/t21-/m0/s1 |
| InChIKey | WBQHKNKNPKDQDU-NRFANRHFSA-N |
| XLogP | 2.50 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |