C22H25N3O3S — CID 24617781
2-methyl-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-1H-indole-3-carboxamide (PubChem CID 24617781) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-methyl-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-1H-indole-3-carboxamide.
| Compound Name | 2-methyl-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 24617781 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-methyl-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-1H-indole-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(NC(=O)c3c(C)[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-15-7-9-18(10-8-15)29(27,28)25-13-11-17(12-14-25)24-22(26)21-16(2)23-20-6-4-3-5-19(20)21/h3-10,17,23H,11-14H2,1-2H3,(H,24,26) |
| InChIKey | PIHRSIFEUZCMBC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |