C22H23N3O4S — CID 43063930
1-(2-methyl-1H-indol-3-yl)-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethane-1,2-dione (PubChem CID 43063930) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-3-yl)-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(2-methyl-1H-indol-3-yl)-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 43063930 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-(2-methyl-1H-indol-3-yl)-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethane-1,2-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)C(=O)c3c(C)[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-15-7-9-17(10-8-15)30(28,29)25-13-11-24(12-14-25)22(27)21(26)20-16(2)23-19-6-4-3-5-18(19)20/h3-10,23H,11-14H2,1-2H3 |
| InChIKey | RLNRBKIVZXJIRP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|