C23H29N3O3 — CID 55650120
1-[4-(azepane-1-carbonyl)piperidin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 55650120) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-[4-(azepane-1-carbonyl)piperidin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(azepane-1-carbonyl)piperidin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 55650120 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[4-(azepane-1-carbonyl)piperidin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)N1CCC(C(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C23H29N3O3/c1-16-20(18-8-4-5-9-19(18)24-16)21(27)23(29)26-14-10-17(11-15-26)22(28)25-12-6-2-3-7-13-25/h4-5,8-9,17,24H,2-3,6-7,10-15H2,1H3 |
| InChIKey | XGAOFAYEGYVXCK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|