C24H22N4O3 — CID 90560341
1-(2-methyl-1H-indol-3-yl)-2-(4-phthalazin-1-yloxypiperidin-1-yl)ethane-1,2-dione (PubChem CID 90560341) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-3-yl)-2-(4-phthalazin-1-yloxypiperidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-(2-methyl-1H-indol-3-yl)-2-(4-phthalazin-1-yloxypiperidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 90560341 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-(2-methyl-1H-indol-3-yl)-2-(4-phthalazin-1-yloxypiperidin-1-yl)ethane-1,2-dione |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)N1CCC(Oc2nncc3ccccc23)CC1 |
| InChI | InChI=1S/C24H22N4O3/c1-15-21(19-8-4-5-9-20(19)26-15)22(29)24(30)28-12-10-17(11-13-28)31-23-18-7-3-2-6-16(18)14-25-27-23/h2-9,14,17,26H,10-13H2,1H3 |
| InChIKey | VIYQNMPFPPUSCL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|