C21H23N5O3 — CID 90637868
1-[3-[6-(dimethylamino)pyrazin-2-yl]oxypyrrolidin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 90637868) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 1-[3-[6-(dimethylamino)pyrazin-2-yl]oxypyrrolidin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[3-[6-(dimethylamino)pyrazin-2-yl]oxypyrrolidin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 90637868 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1-[3-[6-(dimethylamino)pyrazin-2-yl]oxypyrrolidin-1-yl]-2-(2-methyl-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)N1CCC(Oc2cncc(N(C)C)n2)C1 |
| InChI | InChI=1S/C21H23N5O3/c1-13-19(15-6-4-5-7-16(15)23-13)20(27)21(28)26-9-8-14(12-26)29-18-11-22-10-17(24-18)25(2)3/h4-7,10-11,14,23H,8-9,12H2,1-3H3 |
| InChIKey | KJSODCFHBOBZNX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|