C16H20N2 — CID 10037310
3-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1H-indole (PubChem CID 10037310) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1H-indole.
| Compound Name | 3-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1H-indole |
|---|---|
| PubChem CID | 10037310 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1H-indole |
| SMILES | CN1[C@@H]2CC[C@H]1CC(c1c[nH]c3ccccc13)C2 |
| InChI | InChI=1S/C16H20N2/c1-18-12-6-7-13(18)9-11(8-12)15-10-17-16-5-3-2-4-14(15)16/h2-5,10-13,17H,6-9H2,1H3/t11?,12-,13+ |
| InChIKey | FDNYEYVZTCLMFO-YHWZYXNKSA-N |
| XLogP | 3.51 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |