C17H22N2 — CID 152768012
2-(1H-indol-3-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 152768012) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | 2-(1H-indol-3-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 152768012 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | c1ccc2c(C3CCN4CCCCC4C3)c[nH]c2c1 |
| InChI | InChI=1S/C17H22N2/c1-2-7-17-15(6-1)16(12-18-17)13-8-10-19-9-4-3-5-14(19)11-13/h1-2,6-7,12-14,18H,3-5,8-11H2 |
| InChIKey | JFBYLQDKMVAKHH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |