C23H26ClN3 — CID 25165253
3-[3-[4-(3-chlorophenyl)piperazin-1-yl]cyclopentyl]-1H-indole (PubChem CID 25165253) has the molecular formula C23H26ClN3 and a molecular weight of 379.94 g/mol. Its IUPAC name is 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]cyclopentyl]-1H-indole.
| Compound Name | 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]cyclopentyl]-1H-indole |
|---|---|
| PubChem CID | 25165253 |
| Molecular Formula | C23H26ClN3 |
| Molecular Weight | 379.94 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]cyclopentyl]-1H-indole |
| SMILES | Clc1cccc(N2CCN(C3CCC(c4c[nH]c5ccccc45)C3)CC2)c1 |
| InChI | InChI=1S/C23H26ClN3/c24-18-4-3-5-19(15-18)26-10-12-27(13-11-26)20-9-8-17(14-20)22-16-25-23-7-2-1-6-21(22)23/h1-7,15-17,20,25H,8-14H2 |
| InChIKey | ZYHAFMXLGFPGGX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |