C24H29N3O — CID 25166033
5-methoxy-3-[3-(4-phenylpiperazin-1-yl)cyclopentyl]-1H-indole (PubChem CID 25166033) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 5-methoxy-3-[3-(4-phenylpiperazin-1-yl)cyclopentyl]-1H-indole.
| Compound Name | 5-methoxy-3-[3-(4-phenylpiperazin-1-yl)cyclopentyl]-1H-indole |
|---|---|
| PubChem CID | 25166033 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 5-methoxy-3-[3-(4-phenylpiperazin-1-yl)cyclopentyl]-1H-indole |
| SMILES | COc1ccc2[nH]cc(C3CCC(N4CCN(c5ccccc5)CC4)C3)c2c1 |
| InChI | InChI=1S/C24H29N3O/c1-28-21-9-10-24-22(16-21)23(17-25-24)18-7-8-20(15-18)27-13-11-26(12-14-27)19-5-3-2-4-6-19/h2-6,9-10,16-18,20,25H,7-8,11-15H2,1H3 |
| InChIKey | OGYQRGKNJBTSHM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |