C24H25FN4 — CID 25165455
2-[4-[3-(5-fluoro-1H-indol-3-yl)cyclopentyl]piperazin-1-yl]benzonitrile (PubChem CID 25165455) has the molecular formula C24H25FN4 and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-[4-[3-(5-fluoro-1H-indol-3-yl)cyclopentyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-[3-(5-fluoro-1H-indol-3-yl)cyclopentyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 25165455 |
| Molecular Formula | C24H25FN4 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 2-[4-[3-(5-fluoro-1H-indol-3-yl)cyclopentyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCN(C2CCC(c3c[nH]c4ccc(F)cc34)C2)CC1 |
| InChI | InChI=1S/C24H25FN4/c25-19-6-8-23-21(14-19)22(16-27-23)17-5-7-20(13-17)28-9-11-29(12-10-28)24-4-2-1-3-18(24)15-26/h1-4,6,8,14,16-17,20,27H,5,7,9-13H2 |
| InChIKey | UEIMGOKXHVBPHU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |