C29H30N4O — CID 67669036
1-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-1,3-diphenylurea (PubChem CID 67669036) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is 1-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-1,3-diphenylurea.
| Compound Name | 1-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-1,3-diphenylurea |
|---|---|
| PubChem CID | 67669036 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 1-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-1,3-diphenylurea |
| SMILES | O=C(Nc1ccccc1)N(c1ccccc1)c1ccc2[nH]cc(C3CCN4CCCC4C3)c2c1 |
| InChI | InChI=1S/C29H30N4O/c34-29(31-22-8-3-1-4-9-22)33(23-10-5-2-6-11-23)25-13-14-28-26(19-25)27(20-30-28)21-15-17-32-16-7-12-24(32)18-21/h1-6,8-11,13-14,19-21,24,30H,7,12,15-18H2,(H,31,34) |
| InChIKey | CDMJPJRRUATUHP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |