C29H28N4S — CID 57305851
3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-1,1-diphenylthiourea (PubChem CID 57305851) has the molecular formula C29H28N4S and a molecular weight of 464.64 g/mol. Its IUPAC name is 3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-1,1-diphenylthiourea.
| Compound Name | 3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-1,1-diphenylthiourea |
|---|---|
| PubChem CID | 57305851 |
| Molecular Formula | C29H28N4S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-1,1-diphenylthiourea |
| SMILES | S=C(Nc1ccc2[nH]cc(C3=CCN4CCCC4C3)c2c1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28N4S/c34-29(33(23-8-3-1-4-9-23)24-10-5-2-6-11-24)31-22-13-14-28-26(19-22)27(20-30-28)21-15-17-32-16-7-12-25(32)18-21/h1-6,8-11,13-15,19-20,25,30H,7,12,16-18H2,(H,31,34) |
| InChIKey | XXZFLFJETIKNEN-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|