C23H23BrClN5O — CID 67570700
1-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-3-(4-bromo-3-chlorophenyl)urea (PubChem CID 67570700) has the molecular formula C23H23BrClN5O and a molecular weight of 500.83 g/mol. Its IUPAC name is 1-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-3-(4-bromo-3-chlorophenyl)urea.
| Compound Name | 1-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-3-(4-bromo-3-chlorophenyl)urea |
|---|---|
| PubChem CID | 67570700 |
| Molecular Formula | C23H23BrClN5O |
| Molecular Weight | 500.83 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 1-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-3-(4-bromo-3-chlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Br)c(Cl)c1)Nc1ccc2[nH]cc(C3=CCN4CCCCC4C3)c2n1 |
| InChI | InChI=1S/C23H23BrClN5O/c24-18-5-4-15(12-19(18)25)27-23(31)29-21-7-6-20-22(28-21)17(13-26-20)14-8-10-30-9-2-1-3-16(30)11-14/h4-8,12-13,16,26H,1-3,9-11H2,(H2,27,28,29,31) |
| InChIKey | SWBSGICBWTZUHF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.83 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |