C22H29N3O2 — CID 54246048
N-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-4-ethoxybutanamide (PubChem CID 54246048) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-4-ethoxybutanamide.
| Compound Name | N-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-4-ethoxybutanamide |
|---|---|
| PubChem CID | 54246048 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-4-ethoxybutanamide |
| SMILES | CCOCCCC(=O)Nc1ccc2[nH]cc(C3=CCN4CCCC4C3)c2c1 |
| InChI | InChI=1S/C22H29N3O2/c1-2-27-12-4-6-22(26)24-17-7-8-21-19(14-17)20(15-23-21)16-9-11-25-10-3-5-18(25)13-16/h7-9,14-15,18,23H,2-6,10-13H2,1H3,(H,24,26) |
| InChIKey | QTINKUCGVHEMEE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|