C23H22I2N4S — CID 54427163
1-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-3-(2,4-diiodophenyl)thiourea (PubChem CID 54427163) has the molecular formula C23H22I2N4S and a molecular weight of 640.33 g/mol. Its IUPAC name is 1-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-3-(2,4-diiodophenyl)thiourea.
| Compound Name | 1-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-3-(2,4-diiodophenyl)thiourea |
|---|---|
| PubChem CID | 54427163 |
| Molecular Formula | C23H22I2N4S |
| Molecular Weight | 640.33 g/mol |
| Exact Mass | 639.97 |
| IUPAC Name | 1-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-3-(2,4-diiodophenyl)thiourea |
| SMILES | S=C(Nc1ccc2[nH]cc(C3=CCN4CCCC4C3)c2c1)Nc1ccc(I)cc1I |
| InChI | InChI=1S/C23H22I2N4S/c24-15-3-5-22(20(25)11-15)28-23(30)27-16-4-6-21-18(12-16)19(13-26-21)14-7-9-29-8-1-2-17(29)10-14/h3-7,11-13,17,26H,1-2,8-10H2,(H2,27,28,30) |
| InChIKey | WEXBBTGINFEKMQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.33 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|