C22H31N5O — CID 67570374
3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-1,1-dipropylurea (PubChem CID 67570374) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-1,1-dipropylurea.
| Compound Name | 3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 67570374 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1ccc2[nH]cc(C3=CCN4CCCC4C3)c2n1 |
| InChI | InChI=1S/C22H31N5O/c1-3-10-27(11-4-2)22(28)25-20-8-7-19-21(24-20)18(15-23-19)16-9-13-26-12-5-6-17(26)14-16/h7-9,15,17,23H,3-6,10-14H2,1-2H3,(H,24,25,28) |
| InChIKey | ASQDGXUDNAARCQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |