C28H33N3O3S — CID 67570935
N-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-indol-5-yl]-2-butan-2-ylsulfonylbenzamide (PubChem CID 67570935) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is N-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-indol-5-yl]-2-butan-2-ylsulfonylbenzamide.
| Compound Name | N-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-indol-5-yl]-2-butan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 67570935 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-indol-5-yl]-2-butan-2-ylsulfonylbenzamide |
| SMILES | CCC(C)S(=O)(=O)c1ccccc1C(=O)Nc1ccc2[nH]cc(C3=CCN4CCCCC4C3)c2c1 |
| InChI | InChI=1S/C28H33N3O3S/c1-3-19(2)35(33,34)27-10-5-4-9-23(27)28(32)30-21-11-12-26-24(17-21)25(18-29-26)20-13-15-31-14-7-6-8-22(31)16-20/h4-5,9-13,17-19,22,29H,3,6-8,14-16H2,1-2H3,(H,30,32) |
| InChIKey | SBQDCFRCJNTFHE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |