C27H32N4O — CID 54394024
3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-1-butyl-1-phenylurea (PubChem CID 54394024) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is 3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-1-butyl-1-phenylurea.
| Compound Name | 3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-1-butyl-1-phenylurea |
|---|---|
| PubChem CID | 54394024 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 3-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-1-butyl-1-phenylurea |
| SMILES | CCCCN(C(=O)Nc1ccc2[nH]cc(C3=CCN4CCCC4C3)c2c1)c1ccccc1 |
| InChI | InChI=1S/C27H32N4O/c1-2-3-15-31(22-8-5-4-6-9-22)27(32)29-21-11-12-26-24(18-21)25(19-28-26)20-13-16-30-14-7-10-23(30)17-20/h4-6,8-9,11-13,18-19,23,28H,2-3,7,10,14-17H2,1H3,(H,29,32) |
| InChIKey | VIQUGTMOPDKBFH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |