C24H35N5O — CID 67570741
3-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-1-butyl-1-propylurea (PubChem CID 67570741) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is 3-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-1-butyl-1-propylurea.
| Compound Name | 3-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-1-butyl-1-propylurea |
|---|---|
| PubChem CID | 67570741 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 3-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl]-1-butyl-1-propylurea |
| SMILES | CCCCN(CCC)C(=O)Nc1ccc2[nH]cc(C3=CCN4CCCCC4C3)c2n1 |
| InChI | InChI=1S/C24H35N5O/c1-3-5-13-29(12-4-2)24(30)27-22-10-9-21-23(26-22)20(17-25-21)18-11-15-28-14-7-6-8-19(28)16-18/h9-11,17,19,25H,3-8,12-16H2,1-2H3,(H,26,27,30) |
| InChIKey | HNNCZEGRTMCMNG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |