C25H35N3O2 — CID 19710031
[(E)-hex-2-enyl] N-[3-[1-(2,2-dimethylpropyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-indol-5-yl]carbamate (PubChem CID 19710031) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is [(E)-hex-2-enyl] N-[3-[1-(2,2-dimethylpropyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-indol-5-yl]carbamate.
| Compound Name | [(E)-hex-2-enyl] N-[3-[1-(2,2-dimethylpropyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-indol-5-yl]carbamate |
|---|---|
| PubChem CID | 19710031 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | [(E)-hex-2-enyl] N-[3-[1-(2,2-dimethylpropyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-indol-5-yl]carbamate |
| SMILES | CCC/C=C/COC(=O)Nc1ccc2[nH]cc(C3=CCN(CC(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C25H35N3O2/c1-5-6-7-8-15-30-24(29)27-20-9-10-23-21(16-20)22(17-26-23)19-11-13-28(14-12-19)18-25(2,3)4/h7-11,16-17,26H,5-6,12-15,18H2,1-4H3,(H,27,29)/b8-7+ |
| InChIKey | HLQPHQIMQFCGBE-BQYQJAHWSA-N |
| XLogP | 6.21 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|