C21H23FN4O — CID 174406878
1-fluoro-1-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]-3-phenylurea (PubChem CID 174406878) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-fluoro-1-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]-3-phenylurea.
| Compound Name | 1-fluoro-1-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 174406878 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-fluoro-1-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]-3-phenylurea |
| SMILES | CN1CCC(c2c[nH]c3ccc(N(F)C(=O)Nc4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C21H23FN4O/c1-25-11-9-15(10-12-25)19-14-23-20-8-7-17(13-18(19)20)26(22)21(27)24-16-5-3-2-4-6-16/h2-8,13-15,23H,9-12H2,1H3,(H,24,27) |
| InChIKey | HOCTUJJTLISJPF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|