C23H25FN2O2 — CID 69411468
ethyl 2-fluoro-5-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]benzoate (PubChem CID 69411468) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is ethyl 2-fluoro-5-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]benzoate.
| Compound Name | ethyl 2-fluoro-5-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 69411468 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | ethyl 2-fluoro-5-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1cc(CN2CCC(c3c[nH]c4ccccc34)CC2)ccc1F |
| InChI | InChI=1S/C23H25FN2O2/c1-2-28-23(27)19-13-16(7-8-21(19)24)15-26-11-9-17(10-12-26)20-14-25-22-6-4-3-5-18(20)22/h3-8,13-14,17,25H,2,9-12,15H2,1H3 |
| InChIKey | SKHFSFFTSLNZQA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |